| Name | L-Glutamic acid-5-methyl ester |
| Synonyms | Glu(Ome)-OH H-Glu(OMe)-OH O-acetyl-L-homoserine Mono-methyl-L-glutamate L-Gutamic Acid 5-Methyl Ester L-Glutamic Acid 5-Methyl Ester L-Glutamic acid-5-methyl ester (5)-methyl L-hydrogen glutamate 4-amino-5-methoxy-5-oxopentanoic acid (non-preferred name) 2-amino-5-methoxy-5-oxopentanoic acid (non-preferred name) (2S)-2-amino-5-methoxy-5-oxopentanoic acid (non-preferred name) |
| CAS | 1499-55-4 |
| EINECS | 216-110-9 |
| InChI | InChI=1/C6H11NO4/c1-11-6(10)4(7)2-3-5(8)9/h4H,2-3,7H2,1H3,(H,8,9) |
| Molecular Formula | C6H11NO4 |
| Molar Mass | 161.16 |
| Density | 1.3482 (rough estimate) |
| Melting Point | 182 °C (dec.) (lit.) |
| Boling Point | 287.44°C (rough estimate) |
| Specific Rotation(α) | 13 º (c=1, H2O 24 ºC) |
| Flash Point | 137.2°C |
| Water Solubility | Soluble in water |
| Vapor Presure | 0.000217mmHg at 25°C |
| Appearance | Solid |
| Color | White to Almost white |
| BRN | 1725252 |
| pKa | 2.18±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 29 ° (C=2, 6mol/L HC |
| MDL | MFCD00002632 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29224999 |
| use | this product is an intermediate of acetylglutamine. |
| Production method | is obtained by esterification of L-glutamic acid and methanol. Methanol, sulfuric acid and L-glutamic acid were esterified at 20 ℃ for 4h to obtain L-γ-glutamic acid methyl ester. |